CAS 690690-72-3 is the registry number for GPD-1116. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-benzyl-5-phenyl-2H-pyrazolo[4,3-c][1,8]naphthyridin-4-one (CAS 690690-72-3) is a chemical compound with the molecular formula C22H16N4O and a molecular weight of 352.4 g/mol. IUPAC name: 3-benzyl-5-phenyl-2H-pyrazolo[4,3-c][1,8]naphthyridin-4-one. InChIKey: NOZMPLJNURLIAQ-UHFFFAOYSA-N.
| Molecular formula | C22H16N4O |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | 3-benzyl-5-phenyl-2H-pyrazolo[4,3-c][1,8]naphthyridin-4-one |
| InChIKey | NOZMPLJNURLIAQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=C3C(=NN2)C4=C(N=CC=C4)N(C3=O)C5=CC=CC=C5 |
Computed by PubChem (NCBI)