CAS 227616-20-8 appears in our catalog under these names: N-Fmoc-N-methyl-4-methyl-L-phenylalanine, ≥95%, ≥95%, Fmoc-N-Me-Phe(4-Me)-OH, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 1g, 250mg, 5g.
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-(4-methylphenyl)propanoic acid (CAS 227616-20-8) is a chemical compound with the molecular formula C26H25NO4 and a molecular weight of 415.5 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-(4-methylphenyl)propanoic acid. InChIKey: JEFRVZCXEQFQKQ-DEOSSOPVSA-N.
| Molecular formula | C26H25NO4 |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-(4-methylphenyl)propanoic acid |
| InChIKey | JEFRVZCXEQFQKQ-DEOSSOPVSA-N |
| SMILES | CC1=CC=C(C=C1)C[C@@H](C(=O)O)N(C)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)