CAS 227626-60-0 appears in our catalog under these names: Gabapentin Impurity 9, 2–(1–(((tert–Butoxycarbonyl)amino)methyl)cyclohexyl)acetic acid, Boc-Gpn-OH, 2-(1-(((tert-Butoxycarbonyl)amino)methyl)cyclohexyl)acetic acid 97%, 2-(1-(((tert-Butoxycarbonyl)amino)methyl)cyclohexyl)acetic acid, 97%, 97%. Offered by: Chemat Brand, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: on request, 1g, 250mg, 5g, 25g, 100mg.
2-[1-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]acetic acid (CAS 227626-60-0) is a chemical compound with the molecular formula C14H25NO4 and a molecular weight of 271.35 g/mol. IUPAC name: 2-[1-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]acetic acid. InChIKey: YOOHANJKYCQHED-UHFFFAOYSA-N.
| Molecular formula | C14H25NO4 |
|---|---|
| Molecular weight | 271.35 g/mol |
| IUPAC name | 2-[1-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]acetic acid |
| InChIKey | YOOHANJKYCQHED-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1(CCCCC1)CC(=O)O |
Computed by PubChem (NCBI)