CAS 22770-60-1 appears in our catalog under these names: Molindone Impurity 3, Molindone Impurity D. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
3-ethyl-2-methyl-5-methylidene-6,7-dihydro-1H-indol-4-one (CAS 22770-60-1) is a chemical compound with the molecular formula C12H15NO and a molecular weight of 189.25 g/mol. IUPAC name: 3-ethyl-2-methyl-5-methylidene-6,7-dihydro-1H-indol-4-one. InChIKey: WIFPBBZYJFIQIG-UHFFFAOYSA-N.
| Molecular formula | C12H15NO |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | 3-ethyl-2-methyl-5-methylidene-6,7-dihydro-1H-indol-4-one |
| InChIKey | WIFPBBZYJFIQIG-UHFFFAOYSA-N |
| SMILES | CCC1=C(NC2=C1C(=O)C(=C)CC2)C |
Computed by PubChem (NCBI)