CAS 2279121-93-4 is the registry number for 2-(Aminomethyl)-3,5-dimethyl-4h-1,2'-bipyridin-4-one dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
2-(aminomethyl)-3,5-dimethyl-1-pyridin-2-ylpyridin-4-one;dihydrochloride (CAS 2279121-93-4) is a chemical compound with the molecular formula C13H17Cl2N3O and a molecular weight of 302.20 g/mol. IUPAC name: 2-(aminomethyl)-3,5-dimethyl-1-pyridin-2-ylpyridin-4-one;dihydrochloride. InChIKey: DVMCZYDPYQVIDW-UHFFFAOYSA-N.
| Molecular formula | C13H17Cl2N3O |
|---|---|
| Molecular weight | 302.20 g/mol |
| IUPAC name | 2-(aminomethyl)-3,5-dimethyl-1-pyridin-2-ylpyridin-4-one;dihydrochloride |
| InChIKey | DVMCZYDPYQVIDW-UHFFFAOYSA-N |
| SMILES | CC1=CN(C(=C(C1=O)C)CN)C2=CC=CC=N2.Cl.Cl |
Computed by PubChem (NCBI)