CAS 2327471-74-7 appears in our catalog under these names: Cariprazine Impurity 12, Cariprazine Impurity 17. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2,3-dichlorophenyl)-N,N-dimethylpiperazine-1-carboxamide (CAS 2327471-74-7) is a chemical compound with the molecular formula C13H17Cl2N3O and a molecular weight of 302.20 g/mol. IUPAC name: 4-(2,3-dichlorophenyl)-N,N-dimethylpiperazine-1-carboxamide. InChIKey: HRMLGCUNJMGMAI-UHFFFAOYSA-N.
| Molecular formula | C13H17Cl2N3O |
|---|---|
| Molecular weight | 302.20 g/mol |
| IUPAC name | 4-(2,3-dichlorophenyl)-N,N-dimethylpiperazine-1-carboxamide |
| InChIKey | HRMLGCUNJMGMAI-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)N1CCN(CC1)C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)