CAS 2279122-21-1 is the registry number for 2-[2-(8-Chloroimidazo[1,2-a]pyridin-2-yl)ethyl]-1h-isoindole-1,3(2h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[2-(8-chloroimidazo[1,2-a]pyridin-2-yl)ethyl]isoindole-1,3-dione (CAS 2279122-21-1) is a chemical compound with the molecular formula C17H12ClN3O2 and a molecular weight of 325.7 g/mol. IUPAC name: 2-[2-(8-chloroimidazo[1,2-a]pyridin-2-yl)ethyl]isoindole-1,3-dione. InChIKey: FPZCBFPUFUNWNZ-UHFFFAOYSA-N.
| Molecular formula | C17H12ClN3O2 |
|---|---|
| Molecular weight | 325.7 g/mol |
| IUPAC name | 2-[2-(8-chloroimidazo[1,2-a]pyridin-2-yl)ethyl]isoindole-1,3-dione |
| InChIKey | FPZCBFPUFUNWNZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCC3=CN4C=CC=C(C4=N3)Cl |
Computed by PubChem (NCBI)