CAS 36916-20-8 is the registry number for 4-(2-Benzoyl-4-chlorophenyl)-5-methyl-4H-1,2,4-triazole-3-carboxaldehyde, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
4-(2-benzoyl-4-chlorophenyl)-5-methyl-1,2,4-triazole-3-carbaldehyde (CAS 36916-20-8) is a chemical compound with the molecular formula C17H12ClN3O2 and a molecular weight of 325.7 g/mol. IUPAC name: 4-(2-benzoyl-4-chlorophenyl)-5-methyl-1,2,4-triazole-3-carbaldehyde. InChIKey: XCXMEYSBBHIZEF-UHFFFAOYSA-N.
| Molecular formula | C17H12ClN3O2 |
|---|---|
| Molecular weight | 325.7 g/mol |
| IUPAC name | 4-(2-benzoyl-4-chlorophenyl)-5-methyl-1,2,4-triazole-3-carbaldehyde |
| InChIKey | XCXMEYSBBHIZEF-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(N1C2=C(C=C(C=C2)Cl)C(=O)C3=CC=CC=C3)C=O |
Computed by PubChem (NCBI)