CAS 2279123-21-4 is the registry number for 6-Bromo-1-(2,2,2-trifluoro-ethyl)-1h-indole-4-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 6-bromo-1-(2,2,2-trifluoroethyl)indole-4-carboxylate (CAS 2279123-21-4) is a chemical compound with the molecular formula C12H9BrF3NO2 and a molecular weight of 336.10 g/mol. IUPAC name: methyl 6-bromo-1-(2,2,2-trifluoroethyl)indole-4-carboxylate. InChIKey: PHRKOJGMLFPDFB-UHFFFAOYSA-N.
| Molecular formula | C12H9BrF3NO2 |
|---|---|
| Molecular weight | 336.10 g/mol |
| IUPAC name | methyl 6-bromo-1-(2,2,2-trifluoroethyl)indole-4-carboxylate |
| InChIKey | PHRKOJGMLFPDFB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C=CN(C2=CC(=C1)Br)CC(F)(F)F |
Computed by PubChem (NCBI)