CAS 3050687-80-1 is the registry number for CRBN ligand-17. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[3-bromo-2-(trifluoromethyl)phenyl]piperidine-2,6-dione (CAS 3050687-80-1) is a chemical compound with the molecular formula C12H9BrF3NO2 and a molecular weight of 336.10 g/mol. IUPAC name: 3-[3-bromo-2-(trifluoromethyl)phenyl]piperidine-2,6-dione. InChIKey: JTMNRSDNRYHJEU-UHFFFAOYSA-N.
| Molecular formula | C12H9BrF3NO2 |
|---|---|
| Molecular weight | 336.10 g/mol |
| IUPAC name | 3-[3-bromo-2-(trifluoromethyl)phenyl]piperidine-2,6-dione |
| InChIKey | JTMNRSDNRYHJEU-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=C(C(=CC=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)