CAS 2279123-55-4 is the registry number for 3-Amino-n,n-dimethyl-5-thiophen-2-yl-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-amino-N,N-dimethyl-5-thiophen-2-ylbenzamide (CAS 2279123-55-4) is a chemical compound with the molecular formula C13H14N2OS and a molecular weight of 246.33 g/mol. IUPAC name: 3-amino-N,N-dimethyl-5-thiophen-2-ylbenzamide. InChIKey: JKPJTKQOQHYQFP-UHFFFAOYSA-N.
| Molecular formula | C13H14N2OS |
|---|---|
| Molecular weight | 246.33 g/mol |
| IUPAC name | 3-amino-N,N-dimethyl-5-thiophen-2-ylbenzamide |
| InChIKey | JKPJTKQOQHYQFP-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=CC(=C1)C2=CC=CS2)N |
Computed by PubChem (NCBI)