CAS 438194-93-5 appears in our catalog under these names: 2-Amino-5-methyl-4-(4-methylphenyl)thiophene-3-carboxamide, 95%, 2-Amino-5-methyl-4-(p-tolyl)thiophene-3-carboxamide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-amino-5-methyl-4-(4-methylphenyl)thiophene-3-carboxamide (CAS 438194-93-5) is a chemical compound with the molecular formula C13H14N2OS and a molecular weight of 246.33 g/mol. IUPAC name: 2-amino-5-methyl-4-(4-methylphenyl)thiophene-3-carboxamide. InChIKey: CIWIUBJZKACEOO-UHFFFAOYSA-N.
| Molecular formula | C13H14N2OS |
|---|---|
| Molecular weight | 246.33 g/mol |
| IUPAC name | 2-amino-5-methyl-4-(4-methylphenyl)thiophene-3-carboxamide |
| InChIKey | CIWIUBJZKACEOO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(SC(=C2C(=O)N)N)C |
Computed by PubChem (NCBI)