CAS 2279136-04-6 is the registry number for (4Z)-4-(1-Aminoethylidene)-2-(4-fluorophenyl)-5-methyl-2,4-dihydro-3h-pyrazol-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-ethanimidoyl-2-(4-fluorophenyl)-5-methyl-1H-pyrazol-3-one (CAS 2279136-04-6) is a chemical compound with the molecular formula C12H12FN3O and a molecular weight of 233.24 g/mol. IUPAC name: 4-ethanimidoyl-2-(4-fluorophenyl)-5-methyl-1H-pyrazol-3-one. InChIKey: VOZBMSJXSAFWMT-UHFFFAOYSA-N.
| Molecular formula | C12H12FN3O |
|---|---|
| Molecular weight | 233.24 g/mol |
| IUPAC name | 4-ethanimidoyl-2-(4-fluorophenyl)-5-methyl-1H-pyrazol-3-one |
| InChIKey | VOZBMSJXSAFWMT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1)C2=CC=C(C=C2)F)C(=N)C |
Computed by PubChem (NCBI)