CAS 853104-26-4 is the registry number for 3-(4-Fluorophenyl)-5-pyrrolidin-2-yl-1,2,4-oxadiazole, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-(4-fluorophenyl)-5-pyrrolidin-2-yl-1,2,4-oxadiazole (CAS 853104-26-4) is a chemical compound with the molecular formula C12H12FN3O and a molecular weight of 233.24 g/mol. IUPAC name: 3-(4-fluorophenyl)-5-pyrrolidin-2-yl-1,2,4-oxadiazole. InChIKey: MNMVPVCQOZPXSE-UHFFFAOYSA-N.
| Molecular formula | C12H12FN3O |
|---|---|
| Molecular weight | 233.24 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-5-pyrrolidin-2-yl-1,2,4-oxadiazole |
| InChIKey | MNMVPVCQOZPXSE-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=NC(=NO2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)