CAS 2281768-53-2 is the registry number for 2-(3-(N,N-Bis(4-methoxybenzyl)sulfamoyl)-1H-pyrazol-1-yl)-2-methylpropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[3-[bis[(4-methoxyphenyl)methyl]sulfamoyl]pyrazol-1-yl]-2-methylpropanoic acid (CAS 2281768-53-2) is a chemical compound with the molecular formula C23H27N3O6S and a molecular weight of 473.5 g/mol. IUPAC name: 2-[3-[bis[(4-methoxyphenyl)methyl]sulfamoyl]pyrazol-1-yl]-2-methylpropanoic acid. InChIKey: HJJDNZIDWHBPSB-UHFFFAOYSA-N.
| Molecular formula | C23H27N3O6S |
|---|---|
| Molecular weight | 473.5 g/mol |
| IUPAC name | 2-[3-[bis[(4-methoxyphenyl)methyl]sulfamoyl]pyrazol-1-yl]-2-methylpropanoic acid |
| InChIKey | HJJDNZIDWHBPSB-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)N1C=CC(=N1)S(=O)(=O)N(CC2=CC=C(C=C2)OC)CC3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)