CAS 35869-60-4 is the registry number for 1H-Benzimidazolium, 2-[7-(diethylamino)-2-oxo-2H-1-benzopyran-3-yl]-1,3-dimethyl-, methyl sulfate (1:1). Offered by: Chemat. Available pack sizes: 1g, 5g, 25g, 100g.
7-(diethylamino)-3-(1,3-dimethylbenzimidazol-3-ium-2-yl)chromen-2-one;methyl sulfate (CAS 35869-60-4) is a chemical compound with the molecular formula C23H27N3O6S and a molecular weight of 473.5 g/mol. IUPAC name: 7-(diethylamino)-3-(1,3-dimethylbenzimidazol-3-ium-2-yl)chromen-2-one;methyl sulfate. InChIKey: MIAAORZMZPMICQ-UHFFFAOYSA-M.
| Molecular formula | C23H27N3O6S |
|---|---|
| Molecular weight | 473.5 g/mol |
| IUPAC name | 7-(diethylamino)-3-(1,3-dimethylbenzimidazol-3-ium-2-yl)chromen-2-one;methyl sulfate |
| InChIKey | MIAAORZMZPMICQ-UHFFFAOYSA-M |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C=C(C(=O)O2)C3=[N+](C4=CC=CC=C4N3C)C.COS(=O)(=O)[O-] |
Computed by PubChem (NCBI)