CAS 2281899-15-6 is the registry number for 7-(Tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-indole-2,3-dione, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-2,3-dione (CAS 2281899-15-6) is a chemical compound with the molecular formula C14H16BNO4 and a molecular weight of 273.09 g/mol. IUPAC name: 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-2,3-dione. InChIKey: NIWKUHIIZAUJOK-UHFFFAOYSA-N.
| Molecular formula | C14H16BNO4 |
|---|---|
| Molecular weight | 273.09 g/mol |
| IUPAC name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-2,3-dione |
| InChIKey | NIWKUHIIZAUJOK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)C(=O)C(=O)N3 |
Computed by PubChem (NCBI)