CAS 2377611-13-5 appears in our catalog under these names: 3-Cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 96%, 3-Cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 97%, 97%, 3-Cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
3-cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 2377611-13-5) is a chemical compound with the molecular formula C14H16BNO4 and a molecular weight of 273.09 g/mol. IUPAC name: 3-cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: RATFSBRQBGWPSF-UHFFFAOYSA-N.
| Molecular formula | C14H16BNO4 |
|---|---|
| Molecular weight | 273.09 g/mol |
| IUPAC name | 3-cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | RATFSBRQBGWPSF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)C(=O)O)C#N |
Computed by PubChem (NCBI)