Products 228256-58-4
CAS 228256-58-4 is the registry number for 6-bromo-1,2,3,4-tetrahydronaphthalen-1-ol, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-bromo-1,2,3,4-tetrahydronaphthalen-1-ol (CAS 228256-58-4) is a chemical compound with the molecular formula C10H11BrO and a molecular weight of 227.10 g/mol. IUPAC name: 6-bromo-1,2,3,4-tetrahydronaphthalen-1-ol. InChIKey: RFYHJMTWWYDROP-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO |
|---|---|
| Molecular weight | 227.10 g/mol |
| IUPAC name | 6-bromo-1,2,3,4-tetrahydronaphthalen-1-ol |
| InChIKey | RFYHJMTWWYDROP-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C=C(C=C2)Br)O |
Computed by PubChem (NCBI)