CAS 2282708-05-6 is the registry number for Methyl 5-fluoro-2-oxo-2,3-dihydrobenzo[d]oxazole-7-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-fluoro-2-oxo-3H-1,3-benzoxazole-7-carboxylate (CAS 2282708-05-6) is a chemical compound with the molecular formula C9H6FNO4 and a molecular weight of 211.15 g/mol. IUPAC name: methyl 5-fluoro-2-oxo-3H-1,3-benzoxazole-7-carboxylate. InChIKey: KMBHTLXOFZBYTQ-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO4 |
|---|---|
| Molecular weight | 211.15 g/mol |
| IUPAC name | methyl 5-fluoro-2-oxo-3H-1,3-benzoxazole-7-carboxylate |
| InChIKey | KMBHTLXOFZBYTQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=CC(=C1)F)NC(=O)O2 |
Computed by PubChem (NCBI)