CAS 443955-36-0 appears in our catalog under these names: 7-Fluoro-3-oxo-3,4-dihydro-2H-benzo(b)(1,4)oxazine-6-carboxylic acid, 98%, 7-Fluoro-3-oxo-3,4-dihydro-2H-1,4-benzoxazine-6-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
7-fluoro-3-oxo-4H-1,4-benzoxazine-6-carboxylic acid (CAS 443955-36-0) is a chemical compound with the molecular formula C9H6FNO4 and a molecular weight of 211.15 g/mol. IUPAC name: 7-fluoro-3-oxo-4H-1,4-benzoxazine-6-carboxylic acid. InChIKey: RWZKLTNQQDJZKY-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO4 |
|---|---|
| Molecular weight | 211.15 g/mol |
| IUPAC name | 7-fluoro-3-oxo-4H-1,4-benzoxazine-6-carboxylic acid |
| InChIKey | RWZKLTNQQDJZKY-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=C(C(=C2)C(=O)O)F |
Computed by PubChem (NCBI)