Products 2283397-79-3
CAS 2283397-79-3 is the registry number for Perfluoropentanoic acid 13C5 50 µg/mL in Methanol:Water. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.
2,2,3,3,4,4,5,5,5-nonafluoro(1,2,3,4,5-13C5)pentanoic acid (CAS 2283397-79-3) is a chemical compound with the molecular formula C5HF9O2 and a molecular weight of 269.009 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,5-nonafluoro(1,2,3,4,5-13C5)pentanoic acid. InChIKey: CXZGQIAOTKWCDB-CVMUNTFWSA-N.
| Molecular formula | C5HF9O2 |
|---|---|
| Molecular weight | 269.009 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,5-nonafluoro(1,2,3,4,5-13C5)pentanoic acid |
| InChIKey | CXZGQIAOTKWCDB-CVMUNTFWSA-N |
| SMILES | [13C](=O)([13C]([13C]([13C]([13C](F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)