CAS 42031-15-2 appears in our catalog under these names: Hexafluoroisopropyl Trifluoroacetate, Hexafluoroisopropyl trifluoroacetate, ≥98%, ≥98%. Offered by: TRC, Chemat. Available pack sizes: 1g, 25g, 5g.
1,1,1,3,3,3-hexafluoropropan-2-yl 2,2,2-trifluoroacetate (CAS 42031-15-2) is a chemical compound with the molecular formula C5HF9O2 and a molecular weight of 264.05 g/mol. IUPAC name: 1,1,1,3,3,3-hexafluoropropan-2-yl 2,2,2-trifluoroacetate. InChIKey: QFOKVELJLZLFMA-UHFFFAOYSA-N.
| Molecular formula | C5HF9O2 |
|---|---|
| Molecular weight | 264.05 g/mol |
| IUPAC name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2,2,2-trifluoroacetate |
| InChIKey | QFOKVELJLZLFMA-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)(C(F)(F)F)OC(=O)C(F)(F)F |
Computed by PubChem (NCBI)