CAS 228406-56-2 is the registry number for 4-Chloro-N-ethoxycarbonylmethyl-1,8-naphthalimide, 96%, 96%. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
Ethyl 2-(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)acetate (CAS 228406-56-2) is a chemical compound with the molecular formula C16H12ClNO4 and a molecular weight of 317.72 g/mol. IUPAC name: ethyl 2-(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)acetate. InChIKey: WEBHPQJHHPDKEU-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNO4 |
|---|---|
| Molecular weight | 317.72 g/mol |
| IUPAC name | ethyl 2-(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)acetate |
| InChIKey | WEBHPQJHHPDKEU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C(=O)C2=C3C(=C(C=C2)Cl)C=CC=C3C1=O |
Computed by PubChem (NCBI)