Products 252288-17-8
CAS 252288-17-8 is the registry number for Carprofen Impurity 1(Carprofen EP Impurity A ). Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-(6-chloro-9H-carbazol-2-yl)-2-methylpropanedioic acid (CAS 252288-17-8) is a chemical compound with the molecular formula C16H12ClNO4 and a molecular weight of 317.72 g/mol. IUPAC name: 2-(6-chloro-9H-carbazol-2-yl)-2-methylpropanedioic acid. InChIKey: OWNBALBCKYJEQU-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNO4 |
|---|---|
| Molecular weight | 317.72 g/mol |
| IUPAC name | 2-(6-chloro-9H-carbazol-2-yl)-2-methylpropanedioic acid |
| InChIKey | OWNBALBCKYJEQU-UHFFFAOYSA-N |
| SMILES | CC(C1=CC2=C(C=C1)C3=C(N2)C=CC(=C3)Cl)(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(6-Chloro-9H-carbazol-2-yl)-2-methylpropanedioic acid, CARPROFEN FOR VETERINARY USE IMPURITY A [EP IMPURITY], CARPROFEN FOR VETERINARY USE IMPURITY A (EP IMPURITY), Carprofen EP Impurity A, (6-Chloro-9H-carbazol-2-yl)(methyl)propanedioic acid, 2-(6-Chloro-9H-carbazol-2-yl)-2-methylmalonic acid