CAS 22841-97-0 is the registry number for Trenbolone Impurity 3. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
[(8S,13S,14S,17S)-13-methyl-3-oxo-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate (CAS 22841-97-0) is a chemical compound with the molecular formula C20H26O3 and a molecular weight of 314.4 g/mol. IUPAC name: [(8S,13S,14S,17S)-13-methyl-3-oxo-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate. InChIKey: SORZARYJOMHKRB-FYQPLNBISA-N.
| Molecular formula | C20H26O3 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | [(8S,13S,14S,17S)-13-methyl-3-oxo-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
| InChIKey | SORZARYJOMHKRB-FYQPLNBISA-N |
| SMILES | CC(=O)O[C@H]1CC[C@@H]2[C@@]1(CC=C3[C@H]2CCC4=C3CCC(=O)C4)C |
Computed by PubChem (NCBI)