CAS 228411-16-3 appears in our catalog under these names: 2-(4-Dimethylamino-phenyl)-2-methyl-propionic acid, 95%, 2-(4-(Dimethylamino)phenyl)-2-methylpropanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
2-[4-(dimethylamino)phenyl]-2-methylpropanoic acid (CAS 228411-16-3) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: 2-[4-(dimethylamino)phenyl]-2-methylpropanoic acid. InChIKey: AJVDJWZAIIWTRR-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | 2-[4-(dimethylamino)phenyl]-2-methylpropanoic acid |
| InChIKey | AJVDJWZAIIWTRR-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)N(C)C)C(=O)O |
Computed by PubChem (NCBI)