CAS 228425-41-0 is the registry number for N-(4-fluoro-3-nitrophenyl)benzamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
N-(4-fluoro-3-nitrophenyl)benzamide (CAS 228425-41-0) is a chemical compound with the molecular formula C13H9FN2O3 and a molecular weight of 260.22 g/mol. IUPAC name: N-(4-fluoro-3-nitrophenyl)benzamide. InChIKey: BCOQDHDRLDWBDK-UHFFFAOYSA-N.
| Molecular formula | C13H9FN2O3 |
|---|---|
| Molecular weight | 260.22 g/mol |
| IUPAC name | N-(4-fluoro-3-nitrophenyl)benzamide |
| InChIKey | BCOQDHDRLDWBDK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC(=C(C=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)