CAS 344-80-9 appears in our catalog under these names: 2-Amino-5-nitro-2'-fluorobenzophenone, >95% (HPLC), 2–Amino–2–Fluoro–5–Nitrobenzophenone, 2-Amino-5-nitro-2'-fluorobenzophenone, 2-Amino-2'-fluoro-5-nitrobenzophenone 97%, 2-Amino-2'-fluoro-5-nitrobenzophenone, 99.88%. Offered by: TRC, GLPBio, Biosynth, Ambeed, MedChemExpress. Available pack sizes: 10g, 100g, 25g, 50g, 250g, 500g, 1000g, 1g.
(2-amino-5-nitrophenyl)-(2-fluorophenyl)methanone (CAS 344-80-9) is a chemical compound with the molecular formula C13H9FN2O3 and a molecular weight of 260.22 g/mol. IUPAC name: (2-amino-5-nitrophenyl)-(2-fluorophenyl)methanone. InChIKey: ZTEHQPVGEHUXHI-UHFFFAOYSA-N.
| Molecular formula | C13H9FN2O3 |
|---|---|
| Molecular weight | 260.22 g/mol |
| IUPAC name | (2-amino-5-nitrophenyl)-(2-fluorophenyl)methanone |
| InChIKey | ZTEHQPVGEHUXHI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=C(C=CC(=C2)[N+](=O)[O-])N)F |
Computed by PubChem (NCBI)