CAS 2284560-87-6 is the registry number for 2-Bromoimidazo[5,1-b]thiazole-3-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromoimidazo[5,1-b][1,3]thiazole-3-carbaldehyde (CAS 2284560-87-6) is a chemical compound with the molecular formula C6H3BrN2OS and a molecular weight of 231.07 g/mol. IUPAC name: 2-bromoimidazo[5,1-b][1,3]thiazole-3-carbaldehyde. InChIKey: HIBMVEFZCCYUKI-UHFFFAOYSA-N.
| Molecular formula | C6H3BrN2OS |
|---|---|
| Molecular weight | 231.07 g/mol |
| IUPAC name | 2-bromoimidazo[5,1-b][1,3]thiazole-3-carbaldehyde |
| InChIKey | HIBMVEFZCCYUKI-UHFFFAOYSA-N |
| SMILES | C1=C2N(C=N1)C(=C(S2)Br)C=O |
Computed by PubChem (NCBI)