CAS 31169-25-2 appears in our catalog under these names: 7–Bromothieno(3,2–d)pyrimidin–4(3H)–one, 7-Bromothieno[3,2-d]pyrimidin-4(3H)-one, 97%, 97%, 7-Bromothieno[3,2-d]pyrimidin-4(3H)-one, 97%, 7-Bromothieno[3,2-d]pyrimidin-4(3H)-one, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 25g, 10g.
7-bromo-3H-thieno[3,2-d]pyrimidin-4-one (CAS 31169-25-2) is a chemical compound with the molecular formula C6H3BrN2OS and a molecular weight of 231.07 g/mol. IUPAC name: 7-bromo-3H-thieno[3,2-d]pyrimidin-4-one. InChIKey: SFFNZDXKMOSLNK-UHFFFAOYSA-N.
| Molecular formula | C6H3BrN2OS |
|---|---|
| Molecular weight | 231.07 g/mol |
| IUPAC name | 7-bromo-3H-thieno[3,2-d]pyrimidin-4-one |
| InChIKey | SFFNZDXKMOSLNK-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(S1)C(=O)NC=N2)Br |
Computed by PubChem (NCBI)