CAS 2285346-39-4 appears in our catalog under these names: Ilaprazole Impurity 35, Ilaprazole Impurity 26, Ilaprazole Impurity 22, Pyridinium, 4-hydroxy-2,3-dimethyl-1-(6-(1H-pyrrol-1-yl)-1H-benzimidazol-2-yl)-, inner salt. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
2,3-dimethyl-1-(6-pyrrol-1-yl-1H-benzimidazol-2-yl)pyridin-4-one (CAS 2285346-39-4) is a chemical compound with the molecular formula C18H16N4O and a molecular weight of 304.3 g/mol. IUPAC name: 2,3-dimethyl-1-(6-pyrrol-1-yl-1H-benzimidazol-2-yl)pyridin-4-one. InChIKey: QCFJRLIUOGWLQS-UHFFFAOYSA-N.
| Molecular formula | C18H16N4O |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | 2,3-dimethyl-1-(6-pyrrol-1-yl-1H-benzimidazol-2-yl)pyridin-4-one |
| InChIKey | QCFJRLIUOGWLQS-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C=CC1=O)C2=NC3=C(N2)C=C(C=C3)N4C=CC=C4)C |
Computed by PubChem (NCBI)