CAS 98155-57-8 is the registry number for 10-(4-Aminophenyl)-10H-phenoxazine-3,7-diamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
10-(4-aminophenyl)phenoxazine-3,7-diamine (CAS 98155-57-8) is a chemical compound with the molecular formula C18H16N4O and a molecular weight of 304.3 g/mol. IUPAC name: 10-(4-aminophenyl)phenoxazine-3,7-diamine. InChIKey: GUINMVPOFLHHLV-UHFFFAOYSA-N.
| Molecular formula | C18H16N4O |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | 10-(4-aminophenyl)phenoxazine-3,7-diamine |
| InChIKey | GUINMVPOFLHHLV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)N2C3=C(C=C(C=C3)N)OC4=C2C=CC(=C4)N |
Computed by PubChem (NCBI)