Products 2287250-05-7
CAS 2287250-05-7 is the registry number for (3aR)-Hexahydro-1λâ¶-pyrrolo(1,2-b)(1,2)thiazole-1,1,3-trione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3aR)-1,1-dioxo-3a,4,5,6-tetrahydropyrrolo[1,2-b][1,2]thiazol-3-one (CAS 2287250-05-7) is a chemical compound with the molecular formula C6H9NO3S and a molecular weight of 175.21 g/mol. IUPAC name: (3aR)-1,1-dioxo-3a,4,5,6-tetrahydropyrrolo[1,2-b][1,2]thiazol-3-one. InChIKey: JOMVGZHTGUYPSB-RXMQYKEDSA-N.
| Molecular formula | C6H9NO3S |
|---|---|
| Molecular weight | 175.21 g/mol |
| IUPAC name | (3aR)-1,1-dioxo-3a,4,5,6-tetrahydropyrrolo[1,2-b][1,2]thiazol-3-one |
| InChIKey | JOMVGZHTGUYPSB-RXMQYKEDSA-N |
| SMILES | C1C[C@@H]2C(=O)CS(=O)(=O)N2C1 |
Computed by PubChem (NCBI)