Products 2287268-42-0
CAS 2287268-42-0 is the registry number for tert-Butyl 9-imino-9-oxo-1-oxa-9λ6-thia-4-azaspiro(5.5)undecane-4-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 9-imino-9-oxo-1-oxa-9lambda6-thia-4-azaspiro[5.5]undecane-4-carboxylate (CAS 2287268-42-0) is a chemical compound with the molecular formula C13H24N2O4S and a molecular weight of 304.41 g/mol. IUPAC name: tert-butyl 9-imino-9-oxo-1-oxa-9lambda6-thia-4-azaspiro[5.5]undecane-4-carboxylate. InChIKey: HJLKELJSOYNOAV-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O4S |
|---|---|
| Molecular weight | 304.41 g/mol |
| IUPAC name | tert-butyl 9-imino-9-oxo-1-oxa-9lambda6-thia-4-azaspiro[5.5]undecane-4-carboxylate |
| InChIKey | HJLKELJSOYNOAV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC2(C1)CCS(=N)(=O)CC2 |
Computed by PubChem (NCBI)