CAS 2287275-44-7 is the registry number for 3-cyano-2-(pyridin-2-yl)propanoate lithium. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Lithium 3-cyano-2-pyridin-2-ylpropanoate (CAS 2287275-44-7) is a chemical compound with the molecular formula C9H7LiN2O2 and a molecular weight of 182.1 g/mol. IUPAC name: lithium 3-cyano-2-pyridin-2-ylpropanoate. InChIKey: HTTJFDOJFLMMLZ-UHFFFAOYSA-M.
| Molecular formula | C9H7LiN2O2 |
|---|---|
| Molecular weight | 182.1 g/mol |
| IUPAC name | lithium 3-cyano-2-pyridin-2-ylpropanoate |
| InChIKey | HTTJFDOJFLMMLZ-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CC=NC(=C1)C(CC#N)C(=O)[O-] |
Computed by PubChem (NCBI)