CAS 2913245-09-5 is the registry number for Lithium 1-methyl-1H-benzo(d)imidazole-2-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g, 100mg, 50mg.
Lithium 1-methylbenzimidazole-2-carboxylate (CAS 2913245-09-5) is a chemical compound with the molecular formula C9H7LiN2O2 and a molecular weight of 182.1 g/mol. IUPAC name: lithium 1-methylbenzimidazole-2-carboxylate. InChIKey: LTZLKOWAFLUUBI-UHFFFAOYSA-M.
| Molecular formula | C9H7LiN2O2 |
|---|---|
| Molecular weight | 182.1 g/mol |
| IUPAC name | lithium 1-methylbenzimidazole-2-carboxylate |
| InChIKey | LTZLKOWAFLUUBI-UHFFFAOYSA-M |
| SMILES | [Li+].CN1C2=CC=CC=C2N=C1C(=O)[O-] |
Computed by PubChem (NCBI)