CAS 2287297-88-3 is the registry number for 3-(5-Amino-6-fluoro-1H-benzo[d][1,2,3]triazol-1-yl)thietane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1,1-dioxothietan-3-yl)-6-fluorobenzotriazol-5-amine (CAS 2287297-88-3) is a chemical compound with the molecular formula C9H9FN4O2S and a molecular weight of 256.26 g/mol. IUPAC name: 1-(1,1-dioxothietan-3-yl)-6-fluorobenzotriazol-5-amine. InChIKey: MUUCLFFDOYIDMA-UHFFFAOYSA-N.
| Molecular formula | C9H9FN4O2S |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | 1-(1,1-dioxothietan-3-yl)-6-fluorobenzotriazol-5-amine |
| InChIKey | MUUCLFFDOYIDMA-UHFFFAOYSA-N |
| SMILES | C1C(CS1(=O)=O)N2C3=C(C=C(C(=C3)F)N)N=N2 |
Computed by PubChem (NCBI)