CAS 877964-24-4 is the registry number for 2-(5-Phenyl-2H-1,2,3,4-tetrazol-2-yl)ethane-1-sulfonyl fluoride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-(5-phenyltetrazol-2-yl)ethanesulfonyl fluoride (CAS 877964-24-4) is a chemical compound with the molecular formula C9H9FN4O2S and a molecular weight of 256.26 g/mol. IUPAC name: 2-(5-phenyltetrazol-2-yl)ethanesulfonyl fluoride. InChIKey: JHXUJHKVPSNZAO-UHFFFAOYSA-N.
| Molecular formula | C9H9FN4O2S |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | 2-(5-phenyltetrazol-2-yl)ethanesulfonyl fluoride |
| InChIKey | JHXUJHKVPSNZAO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN(N=N2)CCS(=O)(=O)F |
Computed by PubChem (NCBI)