Products 2287344-55-0

CAS 2287344-55-0 is the registry number for 3-(5-Chloro-6-fluoro-1H-benzo[d][1,2,3]triazol-1-yl)thietane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(5-chloro-6-fluorobenzotriazol-1-yl)thietane 1,1-dioxide (CAS 2287344-55-0) is a chemical compound with the molecular formula C9H7ClFN3O2S and a molecular weight of 275.69 g/mol. IUPAC name: 3-(5-chloro-6-fluorobenzotriazol-1-yl)thietane 1,1-dioxide. InChIKey: PMHMKVGXFOBHTF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7ClFN3O2S
Molecular weight275.69 g/mol
IUPAC name3-(5-chloro-6-fluorobenzotriazol-1-yl)thietane 1,1-dioxide
InChIKeyPMHMKVGXFOBHTF-UHFFFAOYSA-N
SMILESC1C(CS1(=O)=O)N2C3=CC(=C(C=C3N=N2)Cl)F

Computed by PubChem (NCBI)