CAS 2763158-77-4 is the registry number for 7-Chloro-8-fluoro-5-methoxy-2-(methylthio)pyrido[4,3-d]pyrimidin-4(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-8-fluoro-5-methoxy-2-methylsulfanyl-3H-pyrido[4,3-d]pyrimidin-4-one (CAS 2763158-77-4) is a chemical compound with the molecular formula C9H7ClFN3O2S and a molecular weight of 275.69 g/mol. IUPAC name: 7-chloro-8-fluoro-5-methoxy-2-methylsulfanyl-3H-pyrido[4,3-d]pyrimidin-4-one. InChIKey: FKTRUJFFWWULMP-UHFFFAOYSA-N.
| Molecular formula | C9H7ClFN3O2S |
|---|---|
| Molecular weight | 275.69 g/mol |
| IUPAC name | 7-chloro-8-fluoro-5-methoxy-2-methylsulfanyl-3H-pyrido[4,3-d]pyrimidin-4-one |
| InChIKey | FKTRUJFFWWULMP-UHFFFAOYSA-N |
| SMILES | COC1=NC(=C(C2=C1C(=O)NC(=N2)SC)F)Cl |
Computed by PubChem (NCBI)