Products 2287345-23-5

CAS 2287345-23-5 is the registry number for 5,5-Dimethylmorpholine-2-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5,5-dimethylmorpholine-2-carboxylic acid;hydrochloride (CAS 2287345-23-5) is a chemical compound with the molecular formula C7H14ClNO3 and a molecular weight of 195.64 g/mol. IUPAC name: 5,5-dimethylmorpholine-2-carboxylic acid;hydrochloride. InChIKey: ILAZEBWUDCSCGT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClNO3
Molecular weight195.64 g/mol
IUPAC name5,5-dimethylmorpholine-2-carboxylic acid;hydrochloride
InChIKeyILAZEBWUDCSCGT-UHFFFAOYSA-N
SMILESCC1(COC(CN1)C(=O)O)C.Cl

Computed by PubChem (NCBI)