CAS 2287346-69-2 appears in our catalog under these names: L–ANAP (trifluoroacetate salt), L-ANAP (TFA). Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 500μg, Get quote.
(2S)-3-[(6-acetylnaphthalen-2-yl)amino]-2-aminopropanoic acid;2,2,2-trifluoroacetic acid (CAS 2287346-69-2) is a chemical compound with the molecular formula C17H17F3N2O5 and a molecular weight of 386.32 g/mol. IUPAC name: (2S)-3-[(6-acetylnaphthalen-2-yl)amino]-2-aminopropanoic acid;2,2,2-trifluoroacetic acid. InChIKey: MSCBUPLAWLNJPO-UQKRIMTDSA-N.
| Molecular formula | C17H17F3N2O5 |
|---|---|
| Molecular weight | 386.32 g/mol |
| IUPAC name | (2S)-3-[(6-acetylnaphthalen-2-yl)amino]-2-aminopropanoic acid;2,2,2-trifluoroacetic acid |
| InChIKey | MSCBUPLAWLNJPO-UQKRIMTDSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)C=C(C=C2)NC[C@@H](C(=O)O)N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)