CAS 3070072-52-2 is the registry number for LPA2 antagonist 5. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R,4R)-3-[3-(prop-2-ynoylamino)phenyl]piperidine-4-carboxylic acid;2,2,2-trifluoroacetic acid (CAS 3070072-52-2) is a chemical compound with the molecular formula C17H17F3N2O5 and a molecular weight of 386.32 g/mol. IUPAC name: (3R,4R)-3-[3-(prop-2-ynoylamino)phenyl]piperidine-4-carboxylic acid;2,2,2-trifluoroacetic acid. InChIKey: LGBIHVDMIAVRIK-KZCZEQIWSA-N.
| Molecular formula | C17H17F3N2O5 |
|---|---|
| Molecular weight | 386.32 g/mol |
| IUPAC name | (3R,4R)-3-[3-(prop-2-ynoylamino)phenyl]piperidine-4-carboxylic acid;2,2,2-trifluoroacetic acid |
| InChIKey | LGBIHVDMIAVRIK-KZCZEQIWSA-N |
| SMILES | C#CC(=O)NC1=CC=CC(=C1)[C@@H]2CNCC[C@H]2C(=O)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)