CAS 2287347-24-2 is the registry number for (1R,6S,7R)-2-Oxobicyclo[4.1.0]heptane-7-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,6S,7R)-2-oxobicyclo[4.1.0]heptane-7-carboxylic acid (CAS 2287347-24-2) is a chemical compound with the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. IUPAC name: (1R,6S,7R)-2-oxobicyclo[4.1.0]heptane-7-carboxylic acid. InChIKey: FGQMQAVNCATITO-JSKYLQRQSA-N.
| Molecular formula | C8H10O3 |
|---|---|
| Molecular weight | 154.16 g/mol |
| IUPAC name | (1R,6S,7R)-2-oxobicyclo[4.1.0]heptane-7-carboxylic acid |
| InChIKey | FGQMQAVNCATITO-JSKYLQRQSA-N |
| SMILES | C1C[C@H]2[C@H]([C@@H]2C(=O)O)C(=O)C1 |
Computed by PubChem (NCBI)