CAS 22882-43-5 appears in our catalog under these names: (1S,2S)-2-Nitrocyclopropanecarboxylic acid, 95%, (1S,2S)-2-Nitrocyclopropanecarboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 100mg.
2-nitrocyclopropane-1-carboxylic acid (CAS 22882-43-5) is a chemical compound with the molecular formula C4H5NO4 and a molecular weight of 131.09 g/mol. IUPAC name: 2-nitrocyclopropane-1-carboxylic acid. InChIKey: ZWYGYMZMGJZSMM-UHFFFAOYSA-N.
| Molecular formula | C4H5NO4 |
|---|---|
| Molecular weight | 131.09 g/mol |
| IUPAC name | 2-nitrocyclopropane-1-carboxylic acid |
| InChIKey | ZWYGYMZMGJZSMM-UHFFFAOYSA-N |
| SMILES | C1C(C1[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)