Products 57528-68-4
CAS 57528-68-4 is the registry number for S-2,3-Dicarboxyaziridine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S,3S)-aziridine-2,3-dicarboxylic acid (CAS 57528-68-4) is a chemical compound with the molecular formula C4H5NO4 and a molecular weight of 131.09 g/mol. IUPAC name: (2S,3S)-aziridine-2,3-dicarboxylic acid. InChIKey: IFCCPDAHQDGHMH-LWMBPPNESA-N.
| Molecular formula | C4H5NO4 |
|---|---|
| Molecular weight | 131.09 g/mol |
| IUPAC name | (2S,3S)-aziridine-2,3-dicarboxylic acid |
| InChIKey | IFCCPDAHQDGHMH-LWMBPPNESA-N |
| SMILES | [C@H]1([C@H](N1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)