CAS 2288708-90-5 is the registry number for (1-(2,2,2-Trifluoroethyl)-1h-indazol-5-yl)methanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[1-(2,2,2-trifluoroethyl)indazol-5-yl]methanamine;hydrochloride (CAS 2288708-90-5) is a chemical compound with the molecular formula C10H11ClF3N3 and a molecular weight of 265.66 g/mol. IUPAC name: [1-(2,2,2-trifluoroethyl)indazol-5-yl]methanamine;hydrochloride. InChIKey: DIUYEEHWYBKXAF-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3N3 |
|---|---|
| Molecular weight | 265.66 g/mol |
| IUPAC name | [1-(2,2,2-trifluoroethyl)indazol-5-yl]methanamine;hydrochloride |
| InChIKey | DIUYEEHWYBKXAF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CN)C=NN2CC(F)(F)F.Cl |
Computed by PubChem (NCBI)