CAS 77992-29-1 is the registry number for 4,5-Dihydro-1-(3-(trifluoromethyl)phenyl)-1H-pyrazol-3-amine Hydrochloride. Offered by: TRC. Available pack sizes: 500mg.
2-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrazol-5-amine;hydrochloride (CAS 77992-29-1) is a chemical compound with the molecular formula C10H11ClF3N3 and a molecular weight of 265.66 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrazol-5-amine;hydrochloride. InChIKey: ZHIVNGPRIADXRQ-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3N3 |
|---|---|
| Molecular weight | 265.66 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrazol-5-amine;hydrochloride |
| InChIKey | ZHIVNGPRIADXRQ-UHFFFAOYSA-N |
| SMILES | C1CN(N=C1N)C2=CC=CC(=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)