CAS 22893-13-6 appears in our catalog under these names: Furosemide Impurity 21, Furosemide Impurity 69, 4-Chloro-3-(furfurylamino)-5-sulfamoylbenzoic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
4-chloro-3-(furan-2-ylmethylamino)-5-sulfamoylbenzoic acid (CAS 22893-13-6) is a chemical compound with the molecular formula C12H11ClN2O5S and a molecular weight of 330.74 g/mol. IUPAC name: 4-chloro-3-(furan-2-ylmethylamino)-5-sulfamoylbenzoic acid. InChIKey: UHPGUPZXEFTJAN-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O5S |
|---|---|
| Molecular weight | 330.74 g/mol |
| IUPAC name | 4-chloro-3-(furan-2-ylmethylamino)-5-sulfamoylbenzoic acid |
| InChIKey | UHPGUPZXEFTJAN-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CNC2=C(C(=CC(=C2)C(=O)O)S(=O)(=O)N)Cl |
Computed by PubChem (NCBI)